About 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one
1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one (PubChem CID 164558584) has the molecular formula C14H14F5N3OS
and a molecular weight of 367.34 g/mol. Its IUPAC name is 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 164558584 |
| Molecular Formula | C14H14F5N3OS |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c(N=C=S)cc(C(F)(F)F)cn1CCCN1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H14F5N3OS/c15-13(16)2-5-21(8-13)3-1-4-22-7-10(14(17,18)19)6-11(12(22)23)20-9-24/h6-7H,1-5,8H2 |
| InChIKey | CWQDUKBPMNSNSG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one (CID 164558584) is 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one is O=c1c(N=C=S)cc(C(F)(F)F)cn1CCCN1CCC(F)(F)C1.
What is the InChIKey of 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is CWQDUKBPMNSNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F5N3OS/c15-13(16)2-5-21(8-13)3-1-4-22-7-10(14(17,18)19)6-11(12(22)23)20-9-24/h6-7H,1-5,8H2.
What are the key properties of 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one?
1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 367.34 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-3-isothiocyanato-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 164558584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).