About 5-fluoropyrazolo[1,5-a]pyridin-3-ol
5-fluoropyrazolo[1,5-a]pyridin-3-ol (PubChem CID 164558792) has the molecular formula C7H5FN2O
and a molecular weight of 152.13 g/mol. Its IUPAC name is 5-fluoropyrazolo[1,5-a]pyridin-3-ol.
Molecular Properties
| Compound Name | 5-fluoropyrazolo[1,5-a]pyridin-3-ol |
| PubChem CID | 164558792 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 5-fluoropyrazolo[1,5-a]pyridin-3-ol |
| SMILES | Oc1cnn2ccc(F)cc12 |
| InChI | InChI=1S/C7H5FN2O/c8-5-1-2-10-6(3-5)7(11)4-9-10/h1-4,11H |
| InChIKey | ZTXSYAKKZDONCP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoropyrazolo[1,5-a]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoropyrazolo[1,5-a]pyridin-3-ol?
The IUPAC name of 5-fluoropyrazolo[1,5-a]pyridin-3-ol (CID 164558792) is 5-fluoropyrazolo[1,5-a]pyridin-3-ol.
What is the SMILES notation for 5-fluoropyrazolo[1,5-a]pyridin-3-ol?
The canonical SMILES for 5-fluoropyrazolo[1,5-a]pyridin-3-ol is Oc1cnn2ccc(F)cc12.
What is the InChIKey of 5-fluoropyrazolo[1,5-a]pyridin-3-ol?
The InChIKey is ZTXSYAKKZDONCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2O/c8-5-1-2-10-6(3-5)7(11)4-9-10/h1-4,11H.
What are the key properties of 5-fluoropyrazolo[1,5-a]pyridin-3-ol?
5-fluoropyrazolo[1,5-a]pyridin-3-ol has a molecular weight of 152.13 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoropyrazolo[1,5-a]pyridin-3-ol is sourced from PubChem (CID 164558792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).