About 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine
3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine (PubChem CID 164558941) has the molecular formula C14H21F3N2O
and a molecular weight of 290.33 g/mol. Its IUPAC name is 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine.
Molecular Properties
| Compound Name | 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine |
| PubChem CID | 164558941 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine |
| SMILES | CN1CCCCC1.COc1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H8F3NO.C6H13N/c1-13-7-3-5(8(9,10)11)2-6(12)4-7;1-7-5-3-2-4-6-7/h2-4H,12H2,1H3;2-6H2,1H3 |
| InChIKey | ABAUACTXIVWEPU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine?
The IUPAC name of 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine (CID 164558941) is 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine.
What is the SMILES notation for 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine?
The canonical SMILES for 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine is CN1CCCCC1.COc1cc(N)cc(C(F)(F)F)c1.
What is the InChIKey of 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine?
The InChIKey is ABAUACTXIVWEPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO.C6H13N/c1-13-7-3-5(8(9,10)11)2-6(12)4-7;1-7-5-3-2-4-6-7/h2-4H,12H2,1H3;2-6H2,1H3.
What are the key properties of 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine?
3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine has a molecular weight of 290.33 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5-(trifluoromethyl)aniline;1-methylpiperidine is sourced from PubChem (CID 164558941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).