About [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate
[5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate (PubChem CID 164559065) has the molecular formula C10H13F2N3S
and a molecular weight of 245.30 g/mol. Its IUPAC name is [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate.
Molecular Properties
| Compound Name | [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate |
| PubChem CID | 164559065 |
| Molecular Formula | C10H13F2N3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate |
| SMILES | CC(C)(C)c1cc(SC#N)nn1CC(F)F |
| InChI | InChI=1S/C10H13F2N3S/c1-10(2,3)7-4-9(16-6-13)14-15(7)5-8(11)12/h4,8H,5H2,1-3H3 |
| InChIKey | PECZXKPLYPRYMZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate?
The IUPAC name of [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate (CID 164559065) is [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate.
What is the SMILES notation for [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate?
The canonical SMILES for [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate is CC(C)(C)c1cc(SC#N)nn1CC(F)F.
What is the InChIKey of [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate?
The InChIKey is PECZXKPLYPRYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2N3S/c1-10(2,3)7-4-9(16-6-13)14-15(7)5-8(11)12/h4,8H,5H2,1-3H3.
What are the key properties of [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate?
[5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate has a molecular weight of 245.30 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-tert-butyl-1-(2,2-difluoroethyl)pyrazol-3-yl] thiocyanate is sourced from PubChem (CID 164559065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).