About 2-tert-butyl-3,5-diethylpyrimidin-4-one
2-tert-butyl-3,5-diethylpyrimidin-4-one (PubChem CID 164559138) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-tert-butyl-3,5-diethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 2-tert-butyl-3,5-diethylpyrimidin-4-one |
| PubChem CID | 164559138 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-tert-butyl-3,5-diethylpyrimidin-4-one |
| SMILES | CCc1cnc(C(C)(C)C)n(CC)c1=O |
| InChI | InChI=1S/C12H20N2O/c1-6-9-8-13-11(12(3,4)5)14(7-2)10(9)15/h8H,6-7H2,1-5H3 |
| InChIKey | XWHUBSBDTLPGSG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-3,5-diethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,5-diethylpyrimidin-4-one?
The IUPAC name of 2-tert-butyl-3,5-diethylpyrimidin-4-one (CID 164559138) is 2-tert-butyl-3,5-diethylpyrimidin-4-one.
What is the SMILES notation for 2-tert-butyl-3,5-diethylpyrimidin-4-one?
The canonical SMILES for 2-tert-butyl-3,5-diethylpyrimidin-4-one is CCc1cnc(C(C)(C)C)n(CC)c1=O.
What is the InChIKey of 2-tert-butyl-3,5-diethylpyrimidin-4-one?
The InChIKey is XWHUBSBDTLPGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-6-9-8-13-11(12(3,4)5)14(7-2)10(9)15/h8H,6-7H2,1-5H3.
What are the key properties of 2-tert-butyl-3,5-diethylpyrimidin-4-one?
2-tert-butyl-3,5-diethylpyrimidin-4-one has a molecular weight of 208.30 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,5-diethylpyrimidin-4-one is sourced from PubChem (CID 164559138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).