About 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol
6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol (PubChem CID 164559163) has the molecular formula C7H4BrFN2O
and a molecular weight of 231.02 g/mol. Its IUPAC name is 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol |
| PubChem CID | 164559163 |
| Molecular Formula | C7H4BrFN2O |
| Molecular Weight | 231.02 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol |
| SMILES | Oc1cnn2cc(Br)cc(F)c12 |
| InChI | InChI=1S/C7H4BrFN2O/c8-4-1-5(9)7-6(12)2-10-11(7)3-4/h1-3,12H |
| InChIKey | DQAXXAKGUDJQBF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.02 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol?
The IUPAC name of 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol (CID 164559163) is 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol.
What is the SMILES notation for 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol?
The canonical SMILES for 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol is Oc1cnn2cc(Br)cc(F)c12.
What is the InChIKey of 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol?
The InChIKey is DQAXXAKGUDJQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFN2O/c8-4-1-5(9)7-6(12)2-10-11(7)3-4/h1-3,12H.
What are the key properties of 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol?
6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol has a molecular weight of 231.02 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-fluoropyrazolo[1,5-a]pyridin-3-ol is sourced from PubChem (CID 164559163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).