About N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide
N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide (PubChem CID 164559263) has the molecular formula C13H18ClN3O3
and a molecular weight of 299.76 g/mol. Its IUPAC name is N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide |
| PubChem CID | 164559263 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(Cl)nn([C@H]2CCOC2)c1=O |
| InChI | InChI=1S/C13H18ClN3O3/c1-13(2,3)12(19)15-9-6-10(14)16-17(11(9)18)8-4-5-20-7-8/h6,8H,4-5,7H2,1-3H3,(H,15,19)/t8-/m0/s1 |
| InChIKey | HNNKFCCVTQPEAV-QMMMGPOBSA-N |
| XLogP | 1.84 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide (CID 164559263) is N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1cc(Cl)nn([C@H]2CCOC2)c1=O.
What is the InChIKey of N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide?
The InChIKey is HNNKFCCVTQPEAV-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H18ClN3O3/c1-13(2,3)12(19)15-9-6-10(14)16-17(11(9)18)8-4-5-20-7-8/h6,8H,4-5,7H2,1-3H3,(H,15,19)/t8-/m0/s1.
What are the key properties of N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide?
N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide has a molecular weight of 299.76 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-chloro-3-oxo-2-[(3S)-oxolan-3-yl]pyridazin-4-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 164559263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).