About N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine
N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine (PubChem CID 164559314) has the molecular formula C12H15F2N5
and a molecular weight of 267.28 g/mol. Its IUPAC name is N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine |
| PubChem CID | 164559314 |
| Molecular Formula | C12H15F2N5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine |
| SMILES | FC1(F)CCN(CCNc2cn3nccc3cn2)C1 |
| InChI | InChI=1S/C12H15F2N5/c13-12(14)2-5-18(9-12)6-4-15-11-8-19-10(7-16-11)1-3-17-19/h1,3,7-8,15H,2,4-6,9H2 |
| InChIKey | DLQUDGZUDAGETH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine?
The IUPAC name of N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine (CID 164559314) is N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine.
What is the SMILES notation for N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine?
The canonical SMILES for N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine is FC1(F)CCN(CCNc2cn3nccc3cn2)C1.
What is the InChIKey of N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine?
The InChIKey is DLQUDGZUDAGETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N5/c13-12(14)2-5-18(9-12)6-4-15-11-8-19-10(7-16-11)1-3-17-19/h1,3,7-8,15H,2,4-6,9H2.
What are the key properties of N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine?
N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine has a molecular weight of 267.28 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyrazolo[1,5-a]pyrazin-6-amine is sourced from PubChem (CID 164559314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).