C10H8F5N3OS — CID 164559605
3-isothiocyanato-1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 164559605) has the molecular formula C10H8F5N3OS and a molecular weight of 313.25 g/mol. Its IUPAC name is 3-isothiocyanato-1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | 3-isothiocyanato-1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 164559605 |
| Molecular Formula | C10H8F5N3OS |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-isothiocyanato-1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | FC(F)(F)C(F)(F)c1cc(N=C=S)nn1[C@H]1CCOC1 |
| InChI | InChI=1S/C10H8F5N3OS/c11-9(12,10(13,14)15)7-3-8(16-5-20)17-18(7)6-1-2-19-4-6/h3,6H,1-2,4H2/t6-/m0/s1 |
| InChIKey | YSCJYPDKWZZDBC-LURJTMIESA-N |
| XLogP | 3.23 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|