About 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol
6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol (PubChem CID 164559630) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol.
Molecular Properties
| Compound Name | 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol |
| PubChem CID | 164559630 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol |
| SMILES | CN(c1cn2ncc(O)c2cn1)C(O)C1CC1 |
| InChI | InChI=1S/C11H14N4O2/c1-14(11(17)7-2-3-7)10-6-15-8(4-12-10)9(16)5-13-15/h4-7,11,16-17H,2-3H2,1H3 |
| InChIKey | CWVAWEAEFBMWSB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 73.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol?
The IUPAC name of 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol (CID 164559630) is 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol.
What is the SMILES notation for 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol?
The canonical SMILES for 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol is CN(c1cn2ncc(O)c2cn1)C(O)C1CC1.
What is the InChIKey of 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol?
The InChIKey is CWVAWEAEFBMWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-14(11(17)7-2-3-7)10-6-15-8(4-12-10)9(16)5-13-15/h4-7,11,16-17H,2-3H2,1H3.
What are the key properties of 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol?
6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol has a molecular weight of 234.26 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[cyclopropyl(hydroxy)methyl]-methylamino]pyrazolo[1,5-a]pyrazin-3-ol is sourced from PubChem (CID 164559630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).