C17H18ClN7O4 — CID 164559870
N-[5-[2-amino-1-[[4-chloro-5-(methylamino)-6-nitro-3-pyridinyl]oxy]ethenyl]pyrazin-2-yl]-N-methylcyclopropanecarboxamide (PubChem CID 164559870) has the molecular formula C17H18ClN7O4 and a molecular weight of 419.83 g/mol. Its IUPAC name is N-[5-[2-amino-1-[[4-chloro-5-(methylamino)-6-nitro-3-pyridinyl]oxy]ethenyl]pyrazin-2-yl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[5-[2-amino-1-[[4-chloro-5-(methylamino)-6-nitro-3-pyridinyl]oxy]ethenyl]pyrazin-2-yl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 164559870 |
| Molecular Formula | C17H18ClN7O4 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[5-[2-amino-1-[[4-chloro-5-(methylamino)-6-nitro-3-pyridinyl]oxy]ethenyl]pyrazin-2-yl]-N-methylcyclopropanecarboxamide |
| SMILES | CNc1c([N+](=O)[O-])ncc(OC(=CN)c2cnc(N(C)C(=O)C3CC3)cn2)c1Cl |
| InChI | InChI=1S/C17H18ClN7O4/c1-20-15-14(18)12(7-23-16(15)25(27)28)29-11(5-19)10-6-22-13(8-21-10)24(2)17(26)9-3-4-9/h5-9,20H,3-4,19H2,1-2H3 |
| InChIKey | JEENAETWVCKBQN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|