C40H38N8O9 — CID 164560494
3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]-N-[3-[[6-(1H-indol-3-yl)pyrimidin-4-yl]amino]phenyl]propanamide (PubChem CID 164560494) has the molecular formula C40H38N8O9 and a molecular weight of 774.79 g/mol. Its IUPAC name is 3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]-N-[3-[[6-(1H-indol-3-yl)pyrimidin-4-yl]amino]phenyl]propanamide.
| Compound Name | 3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]-N-[3-[[6-(1H-indol-3-yl)pyrimidin-4-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 164560494 |
| Molecular Formula | C40H38N8O9 |
| Molecular Weight | 774.79 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | 3-[2-[2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]ethoxy]ethoxy]-N-[3-[[6-(1H-indol-3-yl)pyrimidin-4-yl]amino]phenyl]propanamide |
| SMILES | O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCOCCOCCC(=O)Nc1cccc(Nc2cc(-c3c[nH]c4ccccc34)ncn2)c1 |
| InChI | InChI=1S/C40H38N8O9/c49-34-12-11-31(38(52)47-34)48-39(53)27-8-4-10-32(37(27)40(48)54)57-22-36(51)41-14-16-56-18-17-55-15-13-35(50)46-25-6-3-5-24(19-25)45-33-20-30(43-23-44-33)28-21-42-29-9-2-1-7-26(28)29/h1-10,19-21,23,31,42H,11-18,22H2,(H,41,51)(H,46,50)(H,43,44,45)(H,47,49,52) |
| InChIKey | UUKIBUOTRGQJAN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 223.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|