C24H23F2NO2 — CID 164560616
methyl 1-[5-[2-(2,6-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxylate (PubChem CID 164560616) has the molecular formula C24H23F2NO2 and a molecular weight of 395.45 g/mol. Its IUPAC name is methyl 1-[5-[2-(2,6-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-[2-(2,6-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 164560616 |
| Molecular Formula | C24H23F2NO2 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 1-[5-[2-(2,6-difluorophenyl)ethynyl]-2,3-dihydro-1H-inden-1-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C2CCc3cc(C#Cc4c(F)cccc4F)ccc32)CC1 |
| InChI | InChI=1S/C24H23F2NO2/c1-29-24(28)17-11-13-27(14-12-17)23-10-7-18-15-16(5-8-19(18)23)6-9-20-21(25)3-2-4-22(20)26/h2-5,8,15,17,23H,7,10-14H2,1H3 |
| InChIKey | UKWJOTVYYREOEJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|