C19H22FN3O — CID 164560890
(2-fluoro-3-pyridinyl)-[(2S)-2-methyl-4-[(4-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 164560890) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is (2-fluoro-3-pyridinyl)-[(2S)-2-methyl-4-[(4-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (2-fluoro-3-pyridinyl)-[(2S)-2-methyl-4-[(4-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 164560890 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2-fluoro-3-pyridinyl)-[(2S)-2-methyl-4-[(4-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(CN2CCN(C(=O)c3cccnc3F)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C19H22FN3O/c1-14-5-7-16(8-6-14)13-22-10-11-23(15(2)12-22)19(24)17-4-3-9-21-18(17)20/h3-9,15H,10-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | FYASVKFMSRGKHF-HNNXBMFYSA-N |
| XLogP | 2.88 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|