About 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol
2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol (PubChem CID 164562177) has the molecular formula C28H26N2O3
and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol |
| PubChem CID | 164562177 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol |
| SMILES | CC(C)(O)c1nc2c(cc1N(Cc1ccccc1)Cc1ccccc1)Oc1ccccc1O2 |
| InChI | InChI=1S/C28H26N2O3/c1-28(2,31)26-22(17-25-27(29-26)33-24-16-10-9-15-23(24)32-25)30(18-20-11-5-3-6-12-20)19-21-13-7-4-8-14-21/h3-17,31H,18-19H2,1-2H3 |
| InChIKey | ZCAWASBUAYUHJH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol?
The IUPAC name of 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol (CID 164562177) is 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol.
What is the SMILES notation for 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol?
The canonical SMILES for 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol is CC(C)(O)c1nc2c(cc1N(Cc1ccccc1)Cc1ccccc1)Oc1ccccc1O2.
What is the InChIKey of 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol?
The InChIKey is ZCAWASBUAYUHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O3/c1-28(2,31)26-22(17-25-27(29-26)33-24-16-10-9-15-23(24)32-25)30(18-20-11-5-3-6-12-20)19-21-13-7-4-8-14-21/h3-17,31H,18-19H2,1-2H3.
What are the key properties of 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol?
2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol has a molecular weight of 438.53 g/mol, XLogP of 6.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dibenzylamino)-[1,4]benzodioxino[3,2-b]pyridin-2-yl]propan-2-ol is sourced from PubChem (CID 164562177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).