About 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one
3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one (PubChem CID 164562748) has the molecular formula C15H11ClF3N5O
and a molecular weight of 369.73 g/mol. Its IUPAC name is 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
| PubChem CID | 164562748 |
| Molecular Formula | C15H11ClF3N5O |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one |
| SMILES | Nc1ccc(-n2c(=O)c(N)c(N)c3ccc(C(F)(F)F)nc32)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClF3N5O/c16-8-5-6(20)1-3-9(8)24-13-7(11(21)12(22)14(24)25)2-4-10(23-13)15(17,18)19/h1-5H,20-22H2 |
| InChIKey | FDRORKDWEGERFI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one?
The IUPAC name of 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one (CID 164562748) is 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one.
What is the SMILES notation for 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one?
The canonical SMILES for 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one is Nc1ccc(-n2c(=O)c(N)c(N)c3ccc(C(F)(F)F)nc32)c(Cl)c1.
What is the InChIKey of 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one?
The InChIKey is FDRORKDWEGERFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF3N5O/c16-8-5-6(20)1-3-9(8)24-13-7(11(21)12(22)14(24)25)2-4-10(23-13)15(17,18)19/h1-5H,20-22H2.
What are the key properties of 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one?
3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one has a molecular weight of 369.73 g/mol, XLogP of 2.80, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-1-(4-amino-2-chlorophenyl)-7-(trifluoromethyl)-1,8-naphthyridin-2-one is sourced from PubChem (CID 164562748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).