C21H35N2O5P — CID 164562940
tert-butyl 2-diethoxyphosphoryl-7-(2-methylpropyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (PubChem CID 164562940) has the molecular formula C21H35N2O5P and a molecular weight of 426.49 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-7-(2-methylpropyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-7-(2-methylpropyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 164562940 |
| Molecular Formula | C21H35N2O5P |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-7-(2-methylpropyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| SMILES | CCOP(=O)(OCC)c1ccc2c(n1)CC(CC(C)C)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C21H35N2O5P/c1-8-26-29(25,27-9-2)19-11-10-16-14-23(20(24)28-21(5,6)7)17(12-15(3)4)13-18(16)22-19/h10-11,15,17H,8-9,12-14H2,1-7H3 |
| InChIKey | OZPSAPRYJAUGHB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|