C21H30O3 — CID 164563449
(15R)-6-hydroxy-8-(hydroxymethyl)-4,12,12,14,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one (PubChem CID 164563449) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (15R)-6-hydroxy-8-(hydroxymethyl)-4,12,12,14,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one.
| Compound Name | (15R)-6-hydroxy-8-(hydroxymethyl)-4,12,12,14,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
|---|---|
| PubChem CID | 164563449 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (15R)-6-hydroxy-8-(hydroxymethyl)-4,12,12,14,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
| SMILES | CC1=CC2C3C(C)C(C)C4C(C3C=C(CO)CC2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C21H30O3/c1-10-6-15-16-11(2)12(3)17-18(20(17,4)5)14(16)7-13(9-22)8-21(15,24)19(10)23/h6-7,11-12,14-18,22,24H,8-9H2,1-5H3 |
| InChIKey | KCRBBTFBHQBRGE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|