About tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate
tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate (PubChem CID 164563691) has the molecular formula C20H22N4O5S
and a molecular weight of 430.49 g/mol. Its IUPAC name is tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate |
| PubChem CID | 164563691 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCc1cccc(-c2ccnc3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C20H22N4O5S/c1-20(2,3)29-19(26)24-30(27,28)22-12-13-5-4-6-14(11-13)15-9-10-21-18-16(15)7-8-17(25)23-18/h4-11,22H,12H2,1-3H3,(H,24,26)(H,21,23,25) |
| InChIKey | PSULSKCRGYMUDF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate?
The IUPAC name of tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate (CID 164563691) is tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate.
What is the SMILES notation for tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate?
The canonical SMILES for tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate is CC(C)(C)OC(=O)NS(=O)(=O)NCc1cccc(-c2ccnc3[nH]c(=O)ccc23)c1.
What is the InChIKey of tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate?
The InChIKey is PSULSKCRGYMUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O5S/c1-20(2,3)29-19(26)24-30(27,28)22-12-13-5-4-6-14(11-13)15-9-10-21-18-16(15)7-8-17(25)23-18/h4-11,22H,12H2,1-3H3,(H,24,26)(H,21,23,25).
What are the key properties of tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate?
tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate has a molecular weight of 430.49 g/mol, XLogP of 2.45, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[3-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methylsulfamoyl]carbamate is sourced from PubChem (CID 164563691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).