About 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one
5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one (PubChem CID 164563801) has the molecular formula C19H21N2O4P
and a molecular weight of 372.36 g/mol. Its IUPAC name is 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one |
| PubChem CID | 164563801 |
| Molecular Formula | C19H21N2O4P |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one |
| SMILES | CCOP(=O)(Cc1ccc(-c2ccnc3[nH]c(=O)ccc23)cc1)OCC |
| InChI | InChI=1S/C19H21N2O4P/c1-3-24-26(23,25-4-2)13-14-5-7-15(8-6-14)16-11-12-20-19-17(16)9-10-18(22)21-19/h5-12H,3-4,13H2,1-2H3,(H,20,21,22) |
| InChIKey | AHYVJMDVQSPFHL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one?
The IUPAC name of 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one (CID 164563801) is 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one is CCOP(=O)(Cc1ccc(-c2ccnc3[nH]c(=O)ccc23)cc1)OCC.
What is the InChIKey of 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one?
The InChIKey is AHYVJMDVQSPFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N2O4P/c1-3-24-26(23,25-4-2)13-14-5-7-15(8-6-14)16-11-12-20-19-17(16)9-10-18(22)21-19/h5-12H,3-4,13H2,1-2H3,(H,20,21,22).
What are the key properties of 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one?
5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one has a molecular weight of 372.36 g/mol, XLogP of 4.36, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(diethoxyphosphorylmethyl)phenyl]-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 164563801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).