C48H20BF20N — CID 164564276
dimethyl(phenyl)azanium;tetrakis(1,3,4,5,6-pentafluoronaphthalen-2-yl)boranuide (PubChem CID 164564276) has the molecular formula C48H20BF20N and a molecular weight of 1001.47 g/mol. Its IUPAC name is dimethyl(phenyl)azanium;tetrakis(1,3,4,5,6-pentafluoronaphthalen-2-yl)boranuide.
| Compound Name | dimethyl(phenyl)azanium;tetrakis(1,3,4,5,6-pentafluoronaphthalen-2-yl)boranuide |
|---|---|
| PubChem CID | 164564276 |
| Molecular Formula | C48H20BF20N |
| Molecular Weight | 1001.47 g/mol |
| Exact Mass | 1001.14 |
| IUPAC Name | dimethyl(phenyl)azanium;tetrakis(1,3,4,5,6-pentafluoronaphthalen-2-yl)boranuide |
| SMILES | C[NH+](C)c1ccccc1.Fc1ccc2c(F)c([B-](c3c(F)c(F)c4c(F)c(F)ccc4c3F)(c3c(F)c(F)c4c(F)c(F)ccc4c3F)c3c(F)c(F)c4c(F)c(F)ccc4c3F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C40H8BF20.C8H11N/c42-13-5-1-9-17(29(13)50)33(54)37(58)21(25(9)46)41(22-26(47)10-2-6-14(43)30(51)18(10)34(55)38(22)59,23-27(48)11-3-7-15(44)31(52)19(11)35(56)39(23)60)24-28(49)12-4-8-16(45)32(53)20(12)36(57)40(24)61;1-9(2)8-6-4-3-5-7-8/h1-8H;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | JSBBKYDLZCDCAH-UHFFFAOYSA-O |
| XLogP | 10.92 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.47 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|