About 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol
7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol (PubChem CID 164564331) has the molecular formula C9H16O3S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol.
Molecular Properties
| Compound Name | 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol |
| PubChem CID | 164564331 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol |
| SMILES | CC1(O)CCC2(CC1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C9H16O3S/c1-8(10)2-4-9(5-3-8)6-13(11,12)7-9/h10H,2-7H2,1H3 |
| InChIKey | UMVLXMOQRWYUHD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol?
The IUPAC name of 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol (CID 164564331) is 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol.
What is the SMILES notation for 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol?
The canonical SMILES for 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol is CC1(O)CCC2(CC1)CS(=O)(=O)C2.
What is the InChIKey of 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol?
The InChIKey is UMVLXMOQRWYUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S/c1-8(10)2-4-9(5-3-8)6-13(11,12)7-9/h10H,2-7H2,1H3.
What are the key properties of 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol?
7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol has a molecular weight of 204.29 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,2-dioxo-2λ6-thiaspiro[3.5]nonan-7-ol is sourced from PubChem (CID 164564331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).