C17H26F3NO — CID 164564406
4-cyclopropyl-2-[(2Z)-2-ethenyl-1,1,3-trifluoro-4-methylpenta-2,4-dienyl]morpholine;ethane (PubChem CID 164564406) has the molecular formula C17H26F3NO and a molecular weight of 317.40 g/mol. Its IUPAC name is 4-cyclopropyl-2-[(2Z)-2-ethenyl-1,1,3-trifluoro-4-methylpenta-2,4-dienyl]morpholine;ethane.
| Compound Name | 4-cyclopropyl-2-[(2Z)-2-ethenyl-1,1,3-trifluoro-4-methylpenta-2,4-dienyl]morpholine;ethane |
|---|---|
| PubChem CID | 164564406 |
| Molecular Formula | C17H26F3NO |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 4-cyclopropyl-2-[(2Z)-2-ethenyl-1,1,3-trifluoro-4-methylpenta-2,4-dienyl]morpholine;ethane |
| SMILES | C=C/C(=C(/F)C(=C)C)C(F)(F)C1CN(C2CC2)CCO1.CC |
| InChI | InChI=1S/C15H20F3NO.C2H6/c1-4-12(14(16)10(2)3)15(17,18)13-9-19(7-8-20-13)11-5-6-11;1-2/h4,11,13H,1-2,5-9H2,3H3;1-2H3/b14-12-; |
| InChIKey | QFASGZTXVNZVED-CTMPBGLUSA-N |
| XLogP | 4.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|