About (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine
(E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine (PubChem CID 164564506) has the molecular formula C5H10FN3
and a molecular weight of 131.15 g/mol. Its IUPAC name is (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine |
| PubChem CID | 164564506 |
| Molecular Formula | C5H10FN3 |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine |
| SMILES | CC(F)/N=C/C(N)=C\N |
| InChI | InChI=1S/C5H10FN3/c1-4(6)9-3-5(8)2-7/h2-4H,7-8H2,1H3/b5-2+,9-3+ |
| InChIKey | RQNHZFLXNIKIOP-SKRMJIETSA-N |
| XLogP | 0.13 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine?
The IUPAC name of (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine (CID 164564506) is (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine.
What is the SMILES notation for (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine?
The canonical SMILES for (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine is CC(F)/N=C/C(N)=C\N.
What is the InChIKey of (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine?
The InChIKey is RQNHZFLXNIKIOP-SKRMJIETSA-N. The full InChI is InChI=1S/C5H10FN3/c1-4(6)9-3-5(8)2-7/h2-4H,7-8H2,1H3/b5-2+,9-3+.
What are the key properties of (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine?
(E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine has a molecular weight of 131.15 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3E)-3-(1-fluoroethylimino)prop-1-ene-1,2-diamine is sourced from PubChem (CID 164564506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).