C22H16 — CID 164565159
hexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-3(8),4(21),6,9,11,13,15,17,19-nonaene (PubChem CID 164565159) has the molecular formula C22H16 and a molecular weight of 280.37 g/mol. Its IUPAC name is hexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-3(8),4(21),6,9,11,13,15,17,19-nonaene.
| Compound Name | hexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-3(8),4(21),6,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 164565159 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | hexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-3(8),4(21),6,9,11,13,15,17,19-nonaene |
| SMILES | C1=CC2=C3CC=CC4=C3C3C(=CC=C5C=CC(=C1)C2C53)C=C4 |
| InChI | InChI=1S/C22H16/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-5,7-12,19,21-22H,6H2 |
| InChIKey | DLPVCIHPNSDERY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |