C12H18OS2 — CID 164565273
5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3-dimethyldithiolan-4-ol (PubChem CID 164565273) has the molecular formula C12H18OS2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3-dimethyldithiolan-4-ol.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3-dimethyldithiolan-4-ol |
|---|---|
| PubChem CID | 164565273 |
| Molecular Formula | C12H18OS2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,3-dimethyldithiolan-4-ol |
| SMILES | C=C/C=C(\C=C/C)C1SSC(C)(C)C1O |
| InChI | InChI=1S/C12H18OS2/c1-5-7-9(8-6-2)10-11(13)12(3,4)15-14-10/h5-8,10-11,13H,1H2,2-4H3/b8-6-,9-7+ |
| InChIKey | XGCRPJLCVGZRHX-MKKAVFGOSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|