About hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane
hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane (PubChem CID 164565350) has the molecular formula C6H13O3PS3
and a molecular weight of 260.34 g/mol. Its IUPAC name is hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 164565350 |
| Molecular Formula | C6H13O3PS3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane |
| SMILES | CO[C@H]1CSSC[C@@H]1OP(C)(O)=S |
| InChI | InChI=1S/C6H13O3PS3/c1-8-5-3-12-13-4-6(5)9-10(2,7)11/h5-6H,3-4H2,1-2H3,(H,7,11)/t5-,6-,10?/m0/s1 |
| InChIKey | CQGKQGVKJGPAEW-XBGLIEATSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane?
The IUPAC name of hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane (CID 164565350) is hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane is CO[C@H]1CSSC[C@@H]1OP(C)(O)=S.
What is the InChIKey of hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane?
The InChIKey is CQGKQGVKJGPAEW-XBGLIEATSA-N. The full InChI is InChI=1S/C6H13O3PS3/c1-8-5-3-12-13-4-6(5)9-10(2,7)11/h5-6H,3-4H2,1-2H3,(H,7,11)/t5-,6-,10?/m0/s1.
What are the key properties of hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane?
hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane has a molecular weight of 260.34 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[(4R,5R)-5-methoxydithian-4-yl]oxy-methyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 164565350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).