About ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane
ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane (PubChem CID 164565367) has the molecular formula C14H21FOS2
and a molecular weight of 288.45 g/mol. Its IUPAC name is ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane.
Molecular Properties
| Compound Name | ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane |
| PubChem CID | 164565367 |
| Molecular Formula | C14H21FOS2 |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane |
| SMILES | CC.COC1C(c2ccc(F)cc2)SSC1(C)C |
| InChI | InChI=1S/C12H15FOS2.C2H6/c1-12(2)11(14-3)10(15-16-12)8-4-6-9(13)7-5-8;1-2/h4-7,10-11H,1-3H3;1-2H3 |
| InChIKey | JYYRHMASHMYRIB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane?
The IUPAC name of ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane (CID 164565367) is ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane.
What is the SMILES notation for ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane?
The canonical SMILES for ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane is CC.COC1C(c2ccc(F)cc2)SSC1(C)C.
What is the InChIKey of ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane?
The InChIKey is JYYRHMASHMYRIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FOS2.C2H6/c1-12(2)11(14-3)10(15-16-12)8-4-6-9(13)7-5-8;1-2/h4-7,10-11H,1-3H3;1-2H3.
What are the key properties of ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane?
ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane has a molecular weight of 288.45 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(4-fluorophenyl)-4-methoxy-3,3-dimethyldithiolane is sourced from PubChem (CID 164565367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).