C22H37N2O4PS2 — CID 164565415
1,3-dimethoxybenzene;3-[(3,3-dimethyldithiolan-4-yl)oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 164565415) has the molecular formula C22H37N2O4PS2 and a molecular weight of 488.66 g/mol. Its IUPAC name is 1,3-dimethoxybenzene;3-[(3,3-dimethyldithiolan-4-yl)oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 1,3-dimethoxybenzene;3-[(3,3-dimethyldithiolan-4-yl)oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 164565415 |
| Molecular Formula | C22H37N2O4PS2 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 1,3-dimethoxybenzene;3-[(3,3-dimethyldithiolan-4-yl)oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CSSC1(C)C.COc1cccc(OC)c1 |
| InChI | InChI=1S/C14H27N2O2PS2.C8H10O2/c1-11(2)16(12(3)4)19(17-9-7-8-15)18-13-10-20-21-14(13,5)6;1-9-7-4-3-5-8(6-7)10-2/h11-13H,7,9-10H2,1-6H3;3-6H,1-2H3 |
| InChIKey | PKSUGCSWIBOMKO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|