C17H30O5 — CID 164565492
ethane;2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4-diol (PubChem CID 164565492) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is ethane;2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4-diol.
| Compound Name | ethane;2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4-diol |
|---|---|
| PubChem CID | 164565492 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethane;2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4-diol |
| SMILES | CC.CC.Cc1ccc(OC2CC(O)C(O)C(CO)O2)cc1 |
| InChI | InChI=1S/C13H18O5.2C2H6/c1-8-2-4-9(5-3-8)17-12-6-10(15)13(16)11(7-14)18-12;2*1-2/h2-5,10-16H,6-7H2,1H3;2*1-2H3 |
| InChIKey | SIFHOTBVQKLCDJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |