About 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane
4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane (PubChem CID 164566565) has the molecular formula C22H36N2O
and a molecular weight of 344.54 g/mol. Its IUPAC name is 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane.
Molecular Properties
| Compound Name | 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane |
| PubChem CID | 164566565 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane |
| SMILES | C/C(=C/C(C)C)COC1CCN(c2ccc(C#N)cc2)C1.CC.CC |
| InChI | InChI=1S/C18H24N2O.2C2H6/c1-14(2)10-15(3)13-21-18-8-9-20(12-18)17-6-4-16(11-19)5-7-17;2*1-2/h4-7,10,14,18H,8-9,12-13H2,1-3H3;2*1-2H3/b15-10-;; |
| InChIKey | MMEHDMTXRGNSLV-RDHFQGMDSA-N |
| XLogP | 5.81 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane?
The IUPAC name of 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane (CID 164566565) is 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane.
What is the SMILES notation for 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane?
The canonical SMILES for 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane is C/C(=C/C(C)C)COC1CCN(c2ccc(C#N)cc2)C1.CC.CC.
What is the InChIKey of 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane?
The InChIKey is MMEHDMTXRGNSLV-RDHFQGMDSA-N. The full InChI is InChI=1S/C18H24N2O.2C2H6/c1-14(2)10-15(3)13-21-18-8-9-20(12-18)17-6-4-16(11-19)5-7-17;2*1-2/h4-7,10,14,18H,8-9,12-13H2,1-3H3;2*1-2H3/b15-10-;;.
What are the key properties of 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane?
4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane has a molecular weight of 344.54 g/mol, XLogP of 5.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(Z)-2,4-dimethylpent-2-enoxy]pyrrolidin-1-yl]benzonitrile;ethane is sourced from PubChem (CID 164566565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).