About 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine
4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine (PubChem CID 164567625) has the molecular formula C16H36N2O
and a molecular weight of 272.48 g/mol. Its IUPAC name is 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine.
Molecular Properties
| Compound Name | 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine |
| PubChem CID | 164567625 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine |
| SMILES | CC.CC(C)CN1CCC(OC2CCC2)CC1.CN |
| InChI | InChI=1S/C13H25NO.C2H6.CH5N/c1-11(2)10-14-8-6-13(7-9-14)15-12-4-3-5-12;2*1-2/h11-13H,3-10H2,1-2H3;1-2H3;2H2,1H3 |
| InChIKey | YCCALWKHIZYNNT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine?
The IUPAC name of 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine (CID 164567625) is 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine.
What is the SMILES notation for 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine?
The canonical SMILES for 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine is CC.CC(C)CN1CCC(OC2CCC2)CC1.CN.
What is the InChIKey of 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine?
The InChIKey is YCCALWKHIZYNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO.C2H6.CH5N/c1-11(2)10-14-8-6-13(7-9-14)15-12-4-3-5-12;2*1-2/h11-13H,3-10H2,1-2H3;1-2H3;2H2,1H3.
What are the key properties of 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine?
4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine has a molecular weight of 272.48 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyloxy-1-(2-methylpropyl)piperidine;ethane;methanamine is sourced from PubChem (CID 164567625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).