About ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine
ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine (PubChem CID 164567838) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine.
Molecular Properties
| Compound Name | ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine |
| PubChem CID | 164567838 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine |
| SMILES | CC.[H]/N=C1\CC(C)CC(C)(C)CN1C(C)C |
| InChI | InChI=1S/C12H24N2.C2H6/c1-9(2)14-8-12(4,5)7-10(3)6-11(14)13;1-2/h9-10,13H,6-8H2,1-5H3;1-2H3/b13-11+; |
| InChIKey | SDWIHYUQIBZOFA-BNSHTTSQSA-N |
| XLogP | 4.16 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine?
The IUPAC name of ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine (CID 164567838) is ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine.
What is the SMILES notation for ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine?
The canonical SMILES for ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine is CC.[H]/N=C1\CC(C)CC(C)(C)CN1C(C)C.
What is the InChIKey of ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine?
The InChIKey is SDWIHYUQIBZOFA-BNSHTTSQSA-N. The full InChI is InChI=1S/C12H24N2.C2H6/c1-9(2)14-8-12(4,5)7-10(3)6-11(14)13;1-2/h9-10,13H,6-8H2,1-5H3;1-2H3/b13-11+;.
What are the key properties of ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine?
ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine has a molecular weight of 226.41 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4,6,6-trimethyl-1-propan-2-ylazepan-2-imine is sourced from PubChem (CID 164567838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).