C39H25N3O — CID 164569004
2-cyclohexa-1,5-dien-1-yl-4-[3-(19-oxapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12(17),13,15-nonaen-3-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 164569004) has the molecular formula C39H25N3O and a molecular weight of 551.65 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-[3-(19-oxapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12(17),13,15-nonaen-3-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-[3-(19-oxapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12(17),13,15-nonaen-3-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 164569004 |
| Molecular Formula | C39H25N3O |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-[3-(19-oxapentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6,8,10,12(17),13,15-nonaen-3-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C1=CC(c2nc(-c3ccccc3)nc(-c3cccc(-c4cc5oc6cccc7c8ccccc8c(c4)c5c67)c3)n2)=CCC1 |
| InChI | InChI=1S/C39H25N3O/c1-3-11-24(12-4-1)37-40-38(25-13-5-2-6-14-25)42-39(41-37)27-16-9-15-26(21-27)28-22-32-30-18-8-7-17-29(30)31-19-10-20-33-35(31)36(32)34(23-28)43-33/h1,3-5,7-23H,2,6H2 |
| InChIKey | VEVLLWXELIXCJA-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|