C21H36N6O3 — CID 164570028
N-[(2S)-1-amino-6-[3-(1-methyltriazol-4-yl)propanoylamino]-1-oxohexan-2-yl]cyclooctanecarboxamide (PubChem CID 164570028) has the molecular formula C21H36N6O3 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[(2S)-1-amino-6-[3-(1-methyltriazol-4-yl)propanoylamino]-1-oxohexan-2-yl]cyclooctanecarboxamide.
| Compound Name | N-[(2S)-1-amino-6-[3-(1-methyltriazol-4-yl)propanoylamino]-1-oxohexan-2-yl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 164570028 |
| Molecular Formula | C21H36N6O3 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[(2S)-1-amino-6-[3-(1-methyltriazol-4-yl)propanoylamino]-1-oxohexan-2-yl]cyclooctanecarboxamide |
| SMILES | Cn1cc(CCC(=O)NCCCC[C@H](NC(=O)C2CCCCCCC2)C(N)=O)nn1 |
| InChI | InChI=1S/C21H36N6O3/c1-27-15-17(25-26-27)12-13-19(28)23-14-8-7-11-18(20(22)29)24-21(30)16-9-5-3-2-4-6-10-16/h15-16,18H,2-14H2,1H3,(H2,22,29)(H,23,28)(H,24,30)/t18-/m0/s1 |
| InChIKey | JYNUESBEBYRYNI-SFHVURJKSA-N |
| XLogP | 1.36 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|