C17H8BrF17OS — CID 164571022
2-bromo-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)benzaldehyde (PubChem CID 164571022) has the molecular formula C17H8BrF17OS and a molecular weight of 663.19 g/mol. Its IUPAC name is 2-bromo-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)benzaldehyde.
| Compound Name | 2-bromo-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 164571022 |
| Molecular Formula | C17H8BrF17OS |
| Molecular Weight | 663.19 g/mol |
| Exact Mass | 661.92 |
| IUPAC Name | 2-bromo-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)benzaldehyde |
| SMILES | O=Cc1ccc(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C17H8BrF17OS/c18-9-5-8(2-1-7(9)6-36)37-4-3-10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)35/h1-2,5-6H,3-4H2 |
| InChIKey | NTPMPXQBPUMGBQ-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.19 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|