C8H10FN3O2 — CID 164571588
5-ethyl-2-fluoro-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 164571588) has the molecular formula C8H10FN3O2 and a molecular weight of 199.19 g/mol. Its IUPAC name is 5-ethyl-2-fluoro-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | 5-ethyl-2-fluoro-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 164571588 |
| Molecular Formula | C8H10FN3O2 |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-ethyl-2-fluoro-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | CCC1C=CCn2c(=O)n(F)c(=O)n21 |
| InChI | InChI=1S/C8H10FN3O2/c1-2-6-4-3-5-10-7(13)11(9)8(14)12(6)10/h3-4,6H,2,5H2,1H3 |
| InChIKey | VQBFBQDPZSHYAQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|