C11H13FO2 — CID 164571591
4-(2-fluoroethyl)-3a,4,7,7a-tetrahydroindene-1,3-dione (PubChem CID 164571591) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-3a,4,7,7a-tetrahydroindene-1,3-dione.
| Compound Name | 4-(2-fluoroethyl)-3a,4,7,7a-tetrahydroindene-1,3-dione |
|---|---|
| PubChem CID | 164571591 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 4-(2-fluoroethyl)-3a,4,7,7a-tetrahydroindene-1,3-dione |
| SMILES | O=C1CC(=O)C2C(CCF)C=CCC12 |
| InChI | InChI=1S/C11H13FO2/c12-5-4-7-2-1-3-8-9(13)6-10(14)11(7)8/h1-2,7-8,11H,3-6H2 |
| InChIKey | YCVMVTLEXWYWPI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|