C26H32F3N5OS — CID 164571909
[3-(diethylamino)propylamino]-[2-[4-[2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol (PubChem CID 164571909) has the molecular formula C26H32F3N5OS and a molecular weight of 519.64 g/mol. Its IUPAC name is [3-(diethylamino)propylamino]-[2-[4-[2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol.
| Compound Name | [3-(diethylamino)propylamino]-[2-[4-[2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol |
|---|---|
| PubChem CID | 164571909 |
| Molecular Formula | C26H32F3N5OS |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [3-(diethylamino)propylamino]-[2-[4-[2,2,2-trifluoro-1-(methylamino)ethyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol |
| SMILES | CCN(CC)CCCNC(O)c1ccc2c(c1)sc1nc(-c3ccc(C(NC)C(F)(F)F)cc3)cn12 |
| InChI | InChI=1S/C26H32F3N5OS/c1-4-33(5-2)14-6-13-31-24(35)19-11-12-21-22(15-19)36-25-32-20(16-34(21)25)17-7-9-18(10-8-17)23(30-3)26(27,28)29/h7-12,15-16,23-24,30-31,35H,4-6,13-14H2,1-3H3 |
| InChIKey | VCBBVRMVGBYQJR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|