C17H17N7O — CID 164573002
3-(6-pyridazin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octane-8-carbaldehyde (PubChem CID 164573002) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 3-(6-pyridazin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octane-8-carbaldehyde.
| Compound Name | 3-(6-pyridazin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octane-8-carbaldehyde |
|---|---|
| PubChem CID | 164573002 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-(6-pyridazin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octane-8-carbaldehyde |
| SMILES | O=CN1C2CCC1CN(c1ncnc3[nH]c(-c4ccnnc4)cc13)C2 |
| InChI | InChI=1S/C17H17N7O/c25-10-24-12-1-2-13(24)8-23(7-12)17-14-5-15(11-3-4-20-21-6-11)22-16(14)18-9-19-17/h3-6,9-10,12-13H,1-2,7-8H2,(H,18,19,22) |
| InChIKey | MJVSIQSGZISVLL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|