C18H24N6O — CID 164573020
(1E,3E)-3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyrrolo[1,2-b]pyridazin-6-yl]-1-methoxybuta-1,3-diene-1,4-diamine (PubChem CID 164573020) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is (1E,3E)-3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyrrolo[1,2-b]pyridazin-6-yl]-1-methoxybuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyrrolo[1,2-b]pyridazin-6-yl]-1-methoxybuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 164573020 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1E,3E)-3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyrrolo[1,2-b]pyridazin-6-yl]-1-methoxybuta-1,3-diene-1,4-diamine |
| SMILES | CO/C(N)=C/C(=C\N)c1cc2c(N3CC4CCC(C3)N4)ccnn2c1 |
| InChI | InChI=1S/C18H24N6O/c1-25-18(20)7-12(8-19)13-6-17-16(4-5-21-24(17)9-13)23-10-14-2-3-15(11-23)22-14/h4-9,14-15,22H,2-3,10-11,19-20H2,1H3/b12-8+,18-7+ |
| InChIKey | ZAFBFHSLVVQMPG-BPBPCLDISA-N |
| XLogP | 1.02 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|