About 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione (PubChem CID 164573309) has the molecular formula C16H30N2O8
and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione |
| PubChem CID | 164573309 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione |
| SMILES | CON1C(=O)CCC1=O.NCCOCCOCCOCCOCCC=O |
| InChI | InChI=1S/C11H23NO5.C5H7NO3/c12-2-5-15-7-9-17-11-10-16-8-6-14-4-1-3-13;1-9-6-4(7)2-3-5(6)8/h3H,1-2,4-12H2;2-3H2,1H3 |
| InChIKey | BVRQYMSEEJVHAQ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione?
The IUPAC name of 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione (CID 164573309) is 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione.
What is the SMILES notation for 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione?
The canonical SMILES for 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione is CON1C(=O)CCC1=O.NCCOCCOCCOCCOCCC=O.
What is the InChIKey of 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione?
The InChIKey is BVRQYMSEEJVHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5.C5H7NO3/c12-2-5-15-7-9-17-11-10-16-8-6-14-4-1-3-13;1-9-6-4(7)2-3-5(6)8/h3H,1-2,4-12H2;2-3H2,1H3.
What are the key properties of 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione?
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione has a molecular weight of 378.42 g/mol, XLogP of -0.70, 15 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanal;1-methoxypyrrolidine-2,5-dione is sourced from PubChem (CID 164573309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).