C23H20F3N5O2 — CID 164573373
N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(2,2,2-trifluoroethyl)oxamide (PubChem CID 164573373) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 164573373 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(2,2,2-trifluoroethyl)oxamide |
| SMILES | CCc1ccc(-n2cc(-c3ccc4[nH]cc(NC(=O)C(=O)NCC(F)(F)F)c4c3)cn2)cc1 |
| InChI | InChI=1S/C23H20F3N5O2/c1-2-14-3-6-17(7-4-14)31-12-16(10-29-31)15-5-8-19-18(9-15)20(11-27-19)30-22(33)21(32)28-13-23(24,25)26/h3-12,27H,2,13H2,1H3,(H,28,32)(H,30,33) |
| InChIKey | HWOHKTOHEYIMKT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|