About N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide
N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide (PubChem CID 164573400) has the molecular formula C23H21F2N5O2
and a molecular weight of 437.45 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide |
| PubChem CID | 164573400 |
| Molecular Formula | C23H21F2N5O2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide |
| SMILES | CCc1ccc(-n2cc(-c3ccc4[nH]cc(NC(=O)C(=O)NCC(F)F)c4c3)cn2)cc1 |
| InChI | InChI=1S/C23H21F2N5O2/c1-2-14-3-6-17(7-4-14)30-13-16(10-28-30)15-5-8-19-18(9-15)20(11-26-19)29-23(32)22(31)27-12-21(24)25/h3-11,13,21,26H,2,12H2,1H3,(H,27,31)(H,29,32) |
| InChIKey | GTTLQYAQILKATC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide?
The IUPAC name of N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide (CID 164573400) is N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide?
The canonical SMILES for N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide is CCc1ccc(-n2cc(-c3ccc4[nH]cc(NC(=O)C(=O)NCC(F)F)c4c3)cn2)cc1.
What is the InChIKey of N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide?
The InChIKey is GTTLQYAQILKATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2N5O2/c1-2-14-3-6-17(7-4-14)30-13-16(10-28-30)15-5-8-19-18(9-15)20(11-26-19)29-23(32)22(31)27-12-21(24)25/h3-11,13,21,26H,2,12H2,1H3,(H,27,31)(H,29,32).
What are the key properties of N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide?
N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide has a molecular weight of 437.45 g/mol, XLogP of 3.90, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]oxamide is sourced from PubChem (CID 164573400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).