C21H16F3N5O2 — CID 164573407
N-methyl-N'-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]oxamide (PubChem CID 164573407) has the molecular formula C21H16F3N5O2 and a molecular weight of 427.39 g/mol. Its IUPAC name is N-methyl-N'-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]oxamide.
| Compound Name | N-methyl-N'-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]oxamide |
|---|---|
| PubChem CID | 164573407 |
| Molecular Formula | C21H16F3N5O2 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-methyl-N'-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]oxamide |
| SMILES | CNC(=O)C(=O)Nc1c[nH]c2ccc(-c3cnn(-c4ccc(C(F)(F)F)cc4)c3)cc12 |
| InChI | InChI=1S/C21H16F3N5O2/c1-25-19(30)20(31)28-18-10-26-17-7-2-12(8-16(17)18)13-9-27-29(11-13)15-5-3-14(4-6-15)21(22,23)24/h2-11,26H,1H3,(H,25,30)(H,28,31) |
| InChIKey | ODXAJKCKACGICE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|