C24H22F3N5O2 — CID 164573414
N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(3,3,3-trifluoropropyl)oxamide (PubChem CID 164573414) has the molecular formula C24H22F3N5O2 and a molecular weight of 469.47 g/mol. Its IUPAC name is N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(3,3,3-trifluoropropyl)oxamide.
| Compound Name | N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(3,3,3-trifluoropropyl)oxamide |
|---|---|
| PubChem CID | 164573414 |
| Molecular Formula | C24H22F3N5O2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N'-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-N-(3,3,3-trifluoropropyl)oxamide |
| SMILES | CCc1ccc(-n2cc(-c3ccc4[nH]cc(NC(=O)C(=O)NCCC(F)(F)F)c4c3)cn2)cc1 |
| InChI | InChI=1S/C24H22F3N5O2/c1-2-15-3-6-18(7-4-15)32-14-17(12-30-32)16-5-8-20-19(11-16)21(13-29-20)31-23(34)22(33)28-10-9-24(25,26)27/h3-8,11-14,29H,2,9-10H2,1H3,(H,28,33)(H,31,34) |
| InChIKey | WGCPHAYSEYHHBG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|