About (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine
(4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine (PubChem CID 164573421) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine.
Molecular Properties
| Compound Name | (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine |
| PubChem CID | 164573421 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine |
| SMILES | C=C(N)C(=C)/C=C(\C)c1cnn(-c2ccc(CC)cc2)c1 |
| InChI | InChI=1S/C18H21N3/c1-5-16-6-8-18(9-7-16)21-12-17(11-20-21)14(3)10-13(2)15(4)19/h6-12H,2,4-5,19H2,1,3H3/b14-10+ |
| InChIKey | NRRRBZHORGOQOR-GXDHUFHOSA-N |
| XLogP | 3.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine?
The IUPAC name of (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine (CID 164573421) is (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine.
What is the SMILES notation for (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine?
The canonical SMILES for (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine is C=C(N)C(=C)/C=C(\C)c1cnn(-c2ccc(CC)cc2)c1.
What is the InChIKey of (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine?
The InChIKey is NRRRBZHORGOQOR-GXDHUFHOSA-N. The full InChI is InChI=1S/C18H21N3/c1-5-16-6-8-18(9-7-16)21-12-17(11-20-21)14(3)10-13(2)15(4)19/h6-12H,2,4-5,19H2,1,3H3/b14-10+.
What are the key properties of (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine?
(4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine has a molecular weight of 279.39 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-[1-(4-ethylphenyl)pyrazol-4-yl]-3-methylidenehexa-1,4-dien-2-amine is sourced from PubChem (CID 164573421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).