C9H18N2S — CID 164573527
ethane;2-methyl-1,2,4,5,6,7-hexahydro-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 164573527) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is ethane;2-methyl-1,2,4,5,6,7-hexahydro-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | ethane;2-methyl-1,2,4,5,6,7-hexahydro-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 164573527 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | ethane;2-methyl-1,2,4,5,6,7-hexahydro-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CC.CC1NC2=C(NCCC2)S1 |
| InChI | InChI=1S/C7H12N2S.C2H6/c1-5-9-6-3-2-4-8-7(6)10-5;1-2/h5,8-9H,2-4H2,1H3;1-2H3 |
| InChIKey | NZHCEDPCQUBBBZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |