About 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde
4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde (PubChem CID 164574135) has the molecular formula C12H11NOS
and a molecular weight of 217.29 g/mol. Its IUPAC name is 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde |
| PubChem CID | 164574135 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde |
| SMILES | Cc1cnc(Cc2ccc(C=O)cc2)s1 |
| InChI | InChI=1S/C12H11NOS/c1-9-7-13-12(15-9)6-10-2-4-11(8-14)5-3-10/h2-5,7-8H,6H2,1H3 |
| InChIKey | KCJDPCYLWAGNRB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde?
The IUPAC name of 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde (CID 164574135) is 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde.
What is the SMILES notation for 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde?
The canonical SMILES for 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde is Cc1cnc(Cc2ccc(C=O)cc2)s1.
What is the InChIKey of 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde?
The InChIKey is KCJDPCYLWAGNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NOS/c1-9-7-13-12(15-9)6-10-2-4-11(8-14)5-3-10/h2-5,7-8H,6H2,1H3.
What are the key properties of 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde?
4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde has a molecular weight of 217.29 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-1,3-thiazol-2-yl)methyl]benzaldehyde is sourced from PubChem (CID 164574135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).