C18H35BN2O4 — CID 164574482
N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2,4,4-tetramethylpentanamide (PubChem CID 164574482) has the molecular formula C18H35BN2O4 and a molecular weight of 354.30 g/mol. Its IUPAC name is N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 164574482 |
| Molecular Formula | C18H35BN2O4 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | N-[(1R)-3-amino-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,2,4,4-tetramethylpentanamide |
| SMILES | CC(C)(C)CC(C)(C)C(=O)N[C@@H](CC(N)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H35BN2O4/c1-15(2,3)11-16(4,5)14(23)21-12(10-13(20)22)19-24-17(6,7)18(8,9)25-19/h12H,10-11H2,1-9H3,(H2,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | AXDRRSOLTNBPTA-LBPRGKRZSA-N |
| XLogP | 2.44 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|